C33H36N6O5S — CID 173238625
1-pyridin-2-ylethyl N-[3-[[butan-2-yl-[[4-(2-sulfamoylphenyl)phenyl]carbamoyl]amino]methyl]benzenecarboximidoyl]carbamate (PubChem CID 173238625) has the molecular formula C33H36N6O5S and a molecular weight of 628.76 g/mol. Its IUPAC name is 1-pyridin-2-ylethyl N-[3-[[butan-2-yl-[[4-(2-sulfamoylphenyl)phenyl]carbamoyl]amino]methyl]benzenecarboximidoyl]carbamate.
| Compound Name | 1-pyridin-2-ylethyl N-[3-[[butan-2-yl-[[4-(2-sulfamoylphenyl)phenyl]carbamoyl]amino]methyl]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 173238625 |
| Molecular Formula | C33H36N6O5S |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.25 |
| IUPAC Name | 1-pyridin-2-ylethyl N-[3-[[butan-2-yl-[[4-(2-sulfamoylphenyl)phenyl]carbamoyl]amino]methyl]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)c1ccccn1)c1cccc(CN(C(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)C(C)CC)c1 |
| InChI | InChI=1S/C33H36N6O5S/c1-4-22(2)39(32(40)37-27-17-15-25(16-18-27)28-12-5-6-14-30(28)45(35,42)43)21-24-10-9-11-26(20-24)31(34)38-33(41)44-23(3)29-13-7-8-19-36-29/h5-20,22-23H,4,21H2,1-3H3,(H,37,40)(H2,34,38,41)(H2,35,42,43) |
| InChIKey | KIMRZCZWZTVBIS-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 167.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|