C25H23Cl3N4O6S — CID 173238081
[4-(2-sulfamoylphenyl)phenyl] N-methyl-N-[[3-[N-(2,2,2-trichloroethoxycarbonyl)carbamimidoyl]phenyl]methyl]carbamate (PubChem CID 173238081) has the molecular formula C25H23Cl3N4O6S and a molecular weight of 613.91 g/mol. Its IUPAC name is [4-(2-sulfamoylphenyl)phenyl] N-methyl-N-[[3-[N-(2,2,2-trichloroethoxycarbonyl)carbamimidoyl]phenyl]methyl]carbamate.
| Compound Name | [4-(2-sulfamoylphenyl)phenyl] N-methyl-N-[[3-[N-(2,2,2-trichloroethoxycarbonyl)carbamimidoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 173238081 |
| Molecular Formula | C25H23Cl3N4O6S |
| Molecular Weight | 613.91 g/mol |
| Exact Mass | 612.04 |
| IUPAC Name | [4-(2-sulfamoylphenyl)phenyl] N-methyl-N-[[3-[N-(2,2,2-trichloroethoxycarbonyl)carbamimidoyl]phenyl]methyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OCC(Cl)(Cl)Cl)c1cccc(CN(C)C(=O)Oc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C25H23Cl3N4O6S/c1-32(14-16-5-4-6-18(13-16)22(29)31-23(33)37-15-25(26,27)28)24(34)38-19-11-9-17(10-12-19)20-7-2-3-8-21(20)39(30,35)36/h2-13H,14-15H2,1H3,(H2,29,31,33)(H2,30,35,36) |
| InChIKey | ISENTGGNYAVTMA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 151.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.91 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|