C27H30N4O6S — CID 173238122
1-[3-(N-methoxycarbonylcarbamimidoyl)phenyl]pentan-2-yl-[4-(2-sulfamoylphenyl)phenyl]carbamic acid (PubChem CID 173238122) has the molecular formula C27H30N4O6S and a molecular weight of 538.63 g/mol. Its IUPAC name is 1-[3-(N-methoxycarbonylcarbamimidoyl)phenyl]pentan-2-yl-[4-(2-sulfamoylphenyl)phenyl]carbamic acid.
| Compound Name | 1-[3-(N-methoxycarbonylcarbamimidoyl)phenyl]pentan-2-yl-[4-(2-sulfamoylphenyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 173238122 |
| Molecular Formula | C27H30N4O6S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 1-[3-(N-methoxycarbonylcarbamimidoyl)phenyl]pentan-2-yl-[4-(2-sulfamoylphenyl)phenyl]carbamic acid |
| SMILES | [H]/N=C(\NC(=O)OC)c1cccc(CC(CCC)N(C(=O)O)c2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C27H30N4O6S/c1-3-7-22(17-18-8-6-9-20(16-18)25(28)30-26(32)37-2)31(27(33)34)21-14-12-19(13-15-21)23-10-4-5-11-24(23)38(29,35)36/h4-6,8-16,22H,3,7,17H2,1-2H3,(H,33,34)(H2,28,30,32)(H2,29,35,36) |
| InChIKey | KYHXDAQYJYHFSU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|