C33H44N6O5S — CID 173236269
1-(diethylamino)ethyl N-[3-[[2-oxo-2-[4-(2-sulfamoylphenyl)anilino]ethyl]-pentylamino]benzenecarboximidoyl]carbamate (PubChem CID 173236269) has the molecular formula C33H44N6O5S and a molecular weight of 636.82 g/mol. Its IUPAC name is 1-(diethylamino)ethyl N-[3-[[2-oxo-2-[4-(2-sulfamoylphenyl)anilino]ethyl]-pentylamino]benzenecarboximidoyl]carbamate.
| Compound Name | 1-(diethylamino)ethyl N-[3-[[2-oxo-2-[4-(2-sulfamoylphenyl)anilino]ethyl]-pentylamino]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 173236269 |
| Molecular Formula | C33H44N6O5S |
| Molecular Weight | 636.82 g/mol |
| Exact Mass | 636.31 |
| IUPAC Name | 1-(diethylamino)ethyl N-[3-[[2-oxo-2-[4-(2-sulfamoylphenyl)anilino]ethyl]-pentylamino]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)N(CC)CC)c1cccc(N(CCCCC)CC(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C33H44N6O5S/c1-5-8-11-21-39(28-14-12-13-26(22-28)32(34)37-33(41)44-24(4)38(6-2)7-3)23-31(40)36-27-19-17-25(18-20-27)29-15-9-10-16-30(29)45(35,42)43/h9-10,12-20,22,24H,5-8,11,21,23H2,1-4H3,(H,36,40)(H2,34,37,41)(H2,35,42,43) |
| InChIKey | MNGZWUCGNDEEEY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 157.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.82 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|