C33H34N4O6S — CID 173238123
1-[3-(N-phenoxycarbonylcarbamimidoyl)phenyl]hexan-2-yl-[4-(2-sulfamoylphenyl)phenyl]carbamic acid (PubChem CID 173238123) has the molecular formula C33H34N4O6S and a molecular weight of 614.72 g/mol. Its IUPAC name is 1-[3-(N-phenoxycarbonylcarbamimidoyl)phenyl]hexan-2-yl-[4-(2-sulfamoylphenyl)phenyl]carbamic acid.
| Compound Name | 1-[3-(N-phenoxycarbonylcarbamimidoyl)phenyl]hexan-2-yl-[4-(2-sulfamoylphenyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 173238123 |
| Molecular Formula | C33H34N4O6S |
| Molecular Weight | 614.72 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | 1-[3-(N-phenoxycarbonylcarbamimidoyl)phenyl]hexan-2-yl-[4-(2-sulfamoylphenyl)phenyl]carbamic acid |
| SMILES | [H]/N=C(\NC(=O)Oc1ccccc1)c1cccc(CC(CCCC)N(C(=O)O)c2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C33H34N4O6S/c1-2-3-12-27(22-23-10-9-11-25(21-23)31(34)36-32(38)43-28-13-5-4-6-14-28)37(33(39)40)26-19-17-24(18-20-26)29-15-7-8-16-30(29)44(35,41)42/h4-11,13-21,27H,2-3,12,22H2,1H3,(H,39,40)(H2,34,36,38)(H2,35,41,42) |
| InChIKey | FOBOKTWNSAVBSB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.72 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|