C29H31Cl3N4O5S — CID 173237305
2,2,2-trichloroethyl N-[3-[[2-methylpropyl-[2-[4-(2-sulfamoylphenyl)phenyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate (PubChem CID 173237305) has the molecular formula C29H31Cl3N4O5S and a molecular weight of 654.02 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[3-[[2-methylpropyl-[2-[4-(2-sulfamoylphenyl)phenyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[3-[[2-methylpropyl-[2-[4-(2-sulfamoylphenyl)phenyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 173237305 |
| Molecular Formula | C29H31Cl3N4O5S |
| Molecular Weight | 654.02 g/mol |
| Exact Mass | 652.11 |
| IUPAC Name | 2,2,2-trichloroethyl N-[3-[[2-methylpropyl-[2-[4-(2-sulfamoylphenyl)phenyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OCC(Cl)(Cl)Cl)c1cccc(CN(CC(C)C)C(=O)Cc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C29H31Cl3N4O5S/c1-19(2)16-36(17-21-6-5-7-23(14-21)27(33)35-28(38)41-18-29(30,31)32)26(37)15-20-10-12-22(13-11-20)24-8-3-4-9-25(24)42(34,39)40/h3-14,19H,15-18H2,1-2H3,(H2,33,35,38)(H2,34,39,40) |
| InChIKey | AOSMFEQDOWZLAA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 142.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.02 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|