C31H39N5O6S — CID 173238092
[4-(2-sulfamoylphenyl)phenyl] N-[[3-[N-[1-(diethylamino)ethoxycarbonyl]carbamimidoyl]phenyl]methyl]-N-propan-2-ylcarbamate (PubChem CID 173238092) has the molecular formula C31H39N5O6S and a molecular weight of 609.75 g/mol. Its IUPAC name is [4-(2-sulfamoylphenyl)phenyl] N-[[3-[N-[1-(diethylamino)ethoxycarbonyl]carbamimidoyl]phenyl]methyl]-N-propan-2-ylcarbamate.
| Compound Name | [4-(2-sulfamoylphenyl)phenyl] N-[[3-[N-[1-(diethylamino)ethoxycarbonyl]carbamimidoyl]phenyl]methyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 173238092 |
| Molecular Formula | C31H39N5O6S |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.26 |
| IUPAC Name | [4-(2-sulfamoylphenyl)phenyl] N-[[3-[N-[1-(diethylamino)ethoxycarbonyl]carbamimidoyl]phenyl]methyl]-N-propan-2-ylcarbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)N(CC)CC)c1cccc(CN(C(=O)Oc2ccc(-c3ccccc3S(N)(=O)=O)cc2)C(C)C)c1 |
| InChI | InChI=1S/C31H39N5O6S/c1-6-35(7-2)22(5)41-30(37)34-29(32)25-12-10-11-23(19-25)20-36(21(3)4)31(38)42-26-17-15-24(16-18-26)27-13-8-9-14-28(27)43(33,39)40/h8-19,21-22H,6-7,20H2,1-5H3,(H2,32,34,37)(H2,33,39,40) |
| InChIKey | HSNKJJJGFWMLCL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 155.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|