C24H26N4O5S — CID 142098690
[4-(2-sulfamoylphenyl)phenyl] N-[(3-carbamimidoylphenyl)methyl]-N-(2-methoxyethyl)carbamate (PubChem CID 142098690) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is [4-(2-sulfamoylphenyl)phenyl] N-[(3-carbamimidoylphenyl)methyl]-N-(2-methoxyethyl)carbamate.
| Compound Name | [4-(2-sulfamoylphenyl)phenyl] N-[(3-carbamimidoylphenyl)methyl]-N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 142098690 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | [4-(2-sulfamoylphenyl)phenyl] N-[(3-carbamimidoylphenyl)methyl]-N-(2-methoxyethyl)carbamate |
| SMILES | [H]/N=C(\N)c1cccc(CN(CCOC)C(=O)Oc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C24H26N4O5S/c1-32-14-13-28(16-17-5-4-6-19(15-17)23(25)26)24(29)33-20-11-9-18(10-12-20)21-7-2-3-8-22(21)34(27,30)31/h2-12,15H,13-14,16H2,1H3,(H3,25,26)(H2,27,30,31) |
| InChIKey | UHPUVRVWYSWVRL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 148.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|