C25H25N3O6S — CID 11431907
3-[[(3R,3aR,6S,6aR)-3-[4-(2-sulfamoylphenyl)phenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]benzenecarboximidamide (PubChem CID 11431907) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is 3-[[(3R,3aR,6S,6aR)-3-[4-(2-sulfamoylphenyl)phenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]benzenecarboximidamide.
| Compound Name | 3-[[(3R,3aR,6S,6aR)-3-[4-(2-sulfamoylphenyl)phenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 11431907 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 3-[[(3R,3aR,6S,6aR)-3-[4-(2-sulfamoylphenyl)phenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(O[C@H]2CO[C@H]3[C@@H]2OC[C@H]3Oc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C25H25N3O6S/c26-25(27)16-4-3-5-18(12-16)34-21-14-32-23-20(13-31-24(21)23)33-17-10-8-15(9-11-17)19-6-1-2-7-22(19)35(28,29)30/h1-12,20-21,23-24H,13-14H2,(H3,26,27)(H2,28,29,30)/t20-,21+,23-,24-/m1/s1 |
| InChIKey | LQZHYAZOLBKANO-CBJLPSGESA-N |
| XLogP | 2.28 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|