C25H30N4O3S — CID 70091395
3-[2-methoxyethyl-[2-[4-(2-sulfamoylphenyl)phenyl]propyl]amino]benzenecarboximidamide (PubChem CID 70091395) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is 3-[2-methoxyethyl-[2-[4-(2-sulfamoylphenyl)phenyl]propyl]amino]benzenecarboximidamide.
| Compound Name | 3-[2-methoxyethyl-[2-[4-(2-sulfamoylphenyl)phenyl]propyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 70091395 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 3-[2-methoxyethyl-[2-[4-(2-sulfamoylphenyl)phenyl]propyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N(CCOC)CC(C)c2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C25H30N4O3S/c1-18(17-29(14-15-32-2)22-7-5-6-21(16-22)25(26)27)19-10-12-20(13-11-19)23-8-3-4-9-24(23)33(28,30)31/h3-13,16,18H,14-15,17H2,1-2H3,(H3,26,27)(H2,28,30,31) |
| InChIKey | IVMFWNAYWGUPLY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 122.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|