C28H26FN5O3S — CID 142029949
2-(3-carbamimidoyl-N-methylanilino)-N-[2-fluoro-4-(2-sulfamoylphenyl)phenyl]-2-phenylacetamide (PubChem CID 142029949) has the molecular formula C28H26FN5O3S and a molecular weight of 531.61 g/mol. Its IUPAC name is 2-(3-carbamimidoyl-N-methylanilino)-N-[2-fluoro-4-(2-sulfamoylphenyl)phenyl]-2-phenylacetamide.
| Compound Name | 2-(3-carbamimidoyl-N-methylanilino)-N-[2-fluoro-4-(2-sulfamoylphenyl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 142029949 |
| Molecular Formula | C28H26FN5O3S |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 2-(3-carbamimidoyl-N-methylanilino)-N-[2-fluoro-4-(2-sulfamoylphenyl)phenyl]-2-phenylacetamide |
| SMILES | [H]/N=C(\N)c1cccc(N(C)C(C(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2F)c2ccccc2)c1 |
| InChI | InChI=1S/C28H26FN5O3S/c1-34(21-11-7-10-20(16-21)27(30)31)26(18-8-3-2-4-9-18)28(35)33-24-15-14-19(17-23(24)29)22-12-5-6-13-25(22)38(32,36)37/h2-17,26H,1H3,(H3,30,31)(H,33,35)(H2,32,36,37) |
| InChIKey | HXBGXDPWTCQQST-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 142.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|