C27H31N3O4S — CID 142098688
[4-(2-methylsulfonylphenyl)phenyl] N-[(3-carbamimidoylphenyl)methyl]-N-pentylcarbamate (PubChem CID 142098688) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is [4-(2-methylsulfonylphenyl)phenyl] N-[(3-carbamimidoylphenyl)methyl]-N-pentylcarbamate.
| Compound Name | [4-(2-methylsulfonylphenyl)phenyl] N-[(3-carbamimidoylphenyl)methyl]-N-pentylcarbamate |
|---|---|
| PubChem CID | 142098688 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | [4-(2-methylsulfonylphenyl)phenyl] N-[(3-carbamimidoylphenyl)methyl]-N-pentylcarbamate |
| SMILES | [H]/N=C(\N)c1cccc(CN(CCCCC)C(=O)Oc2ccc(-c3ccccc3S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C27H31N3O4S/c1-3-4-7-17-30(19-20-9-8-10-22(18-20)26(28)29)27(31)34-23-15-13-21(14-16-23)24-11-5-6-12-25(24)35(2,32)33/h5-6,8-16,18H,3-4,7,17,19H2,1-2H3,(H3,28,29) |
| InChIKey | REDQTXIPICWOAW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 113.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|