C28H31N3O3S — CID 175238511
N-[(3-carbamimidoylphenyl)methyl]-N-cyclopentyl-2-(3-methylsulfonyl-4-phenylphenyl)acetamide (PubChem CID 175238511) has the molecular formula C28H31N3O3S and a molecular weight of 489.64 g/mol. Its IUPAC name is N-[(3-carbamimidoylphenyl)methyl]-N-cyclopentyl-2-(3-methylsulfonyl-4-phenylphenyl)acetamide.
| Compound Name | N-[(3-carbamimidoylphenyl)methyl]-N-cyclopentyl-2-(3-methylsulfonyl-4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 175238511 |
| Molecular Formula | C28H31N3O3S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | N-[(3-carbamimidoylphenyl)methyl]-N-cyclopentyl-2-(3-methylsulfonyl-4-phenylphenyl)acetamide |
| SMILES | [H]/N=C(\N)c1cccc(CN(C(=O)Cc2ccc(-c3ccccc3)c(S(C)(=O)=O)c2)C2CCCC2)c1 |
| InChI | InChI=1S/C28H31N3O3S/c1-35(33,34)26-17-20(14-15-25(26)22-9-3-2-4-10-22)18-27(32)31(24-12-5-6-13-24)19-21-8-7-11-23(16-21)28(29)30/h2-4,7-11,14-17,24H,5-6,12-13,18-19H2,1H3,(H3,29,30) |
| InChIKey | HGWZBWHXOACVOZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|