C27H30N4O4S — CID 90788215
N-cyclopentyl-N-[[3-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2-[4-(2-sulfamoylphenyl)phenyl]acetamide (PubChem CID 90788215) has the molecular formula C27H30N4O4S and a molecular weight of 506.63 g/mol. Its IUPAC name is N-cyclopentyl-N-[[3-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2-[4-(2-sulfamoylphenyl)phenyl]acetamide.
| Compound Name | N-cyclopentyl-N-[[3-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2-[4-(2-sulfamoylphenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 90788215 |
| Molecular Formula | C27H30N4O4S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | N-cyclopentyl-N-[[3-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2-[4-(2-sulfamoylphenyl)phenyl]acetamide |
| SMILES | NC(=NO)c1cccc(CN(C(=O)Cc2ccc(-c3ccccc3S(N)(=O)=O)cc2)C2CCCC2)c1 |
| InChI | InChI=1S/C27H30N4O4S/c28-27(30-33)22-7-5-6-20(16-22)18-31(23-8-1-2-9-23)26(32)17-19-12-14-21(15-13-19)24-10-3-4-11-25(24)36(29,34)35/h3-7,10-16,23,33H,1-2,8-9,17-18H2,(H2,28,30)(H2,29,34,35) |
| InChIKey | FWYRWCFRXKMXCO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|