C22H21N5O4S — CID 90924874
2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-[5-(2-sulfamoylphenyl)-2-pyridinyl]cyclopropane-1-carboxamide (PubChem CID 90924874) has the molecular formula C22H21N5O4S and a molecular weight of 451.51 g/mol. Its IUPAC name is 2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-[5-(2-sulfamoylphenyl)-2-pyridinyl]cyclopropane-1-carboxamide.
| Compound Name | 2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-[5-(2-sulfamoylphenyl)-2-pyridinyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 90924874 |
| Molecular Formula | C22H21N5O4S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-[5-(2-sulfamoylphenyl)-2-pyridinyl]cyclopropane-1-carboxamide |
| SMILES | NC(=O)C1(c2ccc(-c3ccccc3S(N)(=O)=O)cn2)CC1c1cccc(C(N)=NO)c1 |
| InChI | InChI=1S/C22H21N5O4S/c23-20(27-29)14-5-3-4-13(10-14)17-11-22(17,21(24)28)19-9-8-15(12-26-19)16-6-1-2-7-18(16)32(25,30)31/h1-10,12,17,29H,11H2,(H2,23,27)(H2,24,28)(H2,25,30,31) |
| InChIKey | JTAYLVLGMMOOID-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 174.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|