C22H20FN5O4S — CID 142012260
(E)-2-fluoro-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-N-[5-(2-sulfamoylphenyl)-2-pyridinyl]but-2-enamide (PubChem CID 142012260) has the molecular formula C22H20FN5O4S and a molecular weight of 469.50 g/mol. Its IUPAC name is (E)-2-fluoro-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-N-[5-(2-sulfamoylphenyl)-2-pyridinyl]but-2-enamide.
| Compound Name | (E)-2-fluoro-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-N-[5-(2-sulfamoylphenyl)-2-pyridinyl]but-2-enamide |
|---|---|
| PubChem CID | 142012260 |
| Molecular Formula | C22H20FN5O4S |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | (E)-2-fluoro-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-N-[5-(2-sulfamoylphenyl)-2-pyridinyl]but-2-enamide |
| SMILES | C/C(=C(\F)C(=O)Nc1ccc(-c2ccccc2S(N)(=O)=O)cn1)c1cccc(/C(N)=N/O)c1 |
| InChI | InChI=1S/C22H20FN5O4S/c1-13(14-5-4-6-15(11-14)21(24)28-30)20(23)22(29)27-19-10-9-16(12-26-19)17-7-2-3-8-18(17)33(25,31)32/h2-12,30H,1H3,(H2,24,28)(H2,25,31,32)(H,26,27,29)/b20-13+ |
| InChIKey | OYGCPIQURJHBMV-DEDYPNTBSA-N |
| XLogP | 2.83 |
| TPSA | 160.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|