C23H20BrFN4O4S — CID 21341391
amino 2-[3-bromo-4-[[(E)-2-fluoro-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]but-2-enoyl]amino]phenyl]benzenesulfinate (PubChem CID 21341391) has the molecular formula C23H20BrFN4O4S and a molecular weight of 547.41 g/mol. Its IUPAC name is amino 2-[3-bromo-4-[[(E)-2-fluoro-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]but-2-enoyl]amino]phenyl]benzenesulfinate.
| Compound Name | amino 2-[3-bromo-4-[[(E)-2-fluoro-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]but-2-enoyl]amino]phenyl]benzenesulfinate |
|---|---|
| PubChem CID | 21341391 |
| Molecular Formula | C23H20BrFN4O4S |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 546.04 |
| IUPAC Name | amino 2-[3-bromo-4-[[(E)-2-fluoro-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]but-2-enoyl]amino]phenyl]benzenesulfinate |
| SMILES | C/C(=C(\F)C(=O)Nc1ccc(-c2ccccc2S(=O)ON)cc1Br)c1cccc(/C(N)=N/O)c1 |
| InChI | InChI=1S/C23H20BrFN4O4S/c1-13(14-5-4-6-16(11-14)22(26)29-31)21(25)23(30)28-19-10-9-15(12-18(19)24)17-7-2-3-8-20(17)34(32)33-27/h2-12,31H,27H2,1H3,(H2,26,29)(H,28,30)/b21-13+ |
| InChIKey | QTUYFUDTLDYJHN-FYJGNVAPSA-N |
| XLogP | 4.46 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|