C23H19FILiN4O3S — CID 142012330
lithium [amino-[3-[(E)-3-fluoro-4-[2-iodo-4-(2-sulfamoylphenyl)anilino]-4-oxobut-2-en-2-yl]phenyl]methylidene]azanide (PubChem CID 142012330) has the molecular formula C23H19FILiN4O3S and a molecular weight of 584.34 g/mol. Its IUPAC name is lithium [amino-[3-[(E)-3-fluoro-4-[2-iodo-4-(2-sulfamoylphenyl)anilino]-4-oxobut-2-en-2-yl]phenyl]methylidene]azanide.
| Compound Name | lithium [amino-[3-[(E)-3-fluoro-4-[2-iodo-4-(2-sulfamoylphenyl)anilino]-4-oxobut-2-en-2-yl]phenyl]methylidene]azanide |
|---|---|
| PubChem CID | 142012330 |
| Molecular Formula | C23H19FILiN4O3S |
| Molecular Weight | 584.34 g/mol |
| Exact Mass | 584.04 |
| IUPAC Name | lithium [amino-[3-[(E)-3-fluoro-4-[2-iodo-4-(2-sulfamoylphenyl)anilino]-4-oxobut-2-en-2-yl]phenyl]methylidene]azanide |
| SMILES | C/C(=C(\F)C(=O)Nc1ccc(-c2ccccc2S(N)(=O)=O)cc1I)c1cccc(C(=[N-])N)c1.[Li+] |
| InChI | InChI=1S/C23H19FIN4O3S.Li/c1-13(14-5-4-6-16(11-14)22(26)27)21(24)23(30)29-19-10-9-15(12-18(19)25)17-7-2-3-8-20(17)33(28,31)32;/h2-12H,1H3,(H5-,26,27,28,29,30,31,32);/q-1;+1/b21-13+; |
| InChIKey | TULXMKHHVYGFOZ-PGCULMPHSA-N |
| XLogP | 1.22 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|