C25H21FN4O4S — CID 72590274
amino 2-[4-[[3-(1-aminoisoquinolin-7-yl)-2-fluorobut-2-enoyl]amino]-3-hydroxyphenyl]benzenesulfinate (PubChem CID 72590274) has the molecular formula C25H21FN4O4S and a molecular weight of 492.53 g/mol. Its IUPAC name is amino 2-[4-[[3-(1-aminoisoquinolin-7-yl)-2-fluorobut-2-enoyl]amino]-3-hydroxyphenyl]benzenesulfinate.
| Compound Name | amino 2-[4-[[3-(1-aminoisoquinolin-7-yl)-2-fluorobut-2-enoyl]amino]-3-hydroxyphenyl]benzenesulfinate |
|---|---|
| PubChem CID | 72590274 |
| Molecular Formula | C25H21FN4O4S |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | amino 2-[4-[[3-(1-aminoisoquinolin-7-yl)-2-fluorobut-2-enoyl]amino]-3-hydroxyphenyl]benzenesulfinate |
| SMILES | CC(=C(F)C(=O)Nc1ccc(-c2ccccc2S(=O)ON)cc1O)c1ccc2ccnc(N)c2c1 |
| InChI | InChI=1S/C25H21FN4O4S/c1-14(16-7-6-15-10-11-29-24(27)19(15)12-16)23(26)25(32)30-20-9-8-17(13-21(20)31)18-4-2-3-5-22(18)35(33)34-28/h2-13,31H,28H2,1H3,(H2,27,29)(H,30,32) |
| InChIKey | XDVHZXRZKAQGEY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 140.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|