C24H24N4O2 — CID 167652755
N-[(1-aminoisoquinolin-6-yl)methyl]-5-(2-methoxyphenyl)pyridine-3-carboxamide;methane (PubChem CID 167652755) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[(1-aminoisoquinolin-6-yl)methyl]-5-(2-methoxyphenyl)pyridine-3-carboxamide;methane.
| Compound Name | N-[(1-aminoisoquinolin-6-yl)methyl]-5-(2-methoxyphenyl)pyridine-3-carboxamide;methane |
|---|---|
| PubChem CID | 167652755 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-[(1-aminoisoquinolin-6-yl)methyl]-5-(2-methoxyphenyl)pyridine-3-carboxamide;methane |
| SMILES | C.COc1ccccc1-c1cncc(C(=O)NCc2ccc3c(N)nccc3c2)c1 |
| InChI | InChI=1S/C23H20N4O2.CH4/c1-29-21-5-3-2-4-19(21)17-11-18(14-25-13-17)23(28)27-12-15-6-7-20-16(10-15)8-9-26-22(20)24;/h2-11,13-14H,12H2,1H3,(H2,24,26)(H,27,28);1H4 |
| InChIKey | QUUQFGQUKGNIIE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |