C15H18N4O2 — CID 139341030
methyl 2-[(1-aminoisoquinolin-6-yl)methylamino]-N-ethyl-2-oxoethanimidate (PubChem CID 139341030) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is methyl 2-[(1-aminoisoquinolin-6-yl)methylamino]-N-ethyl-2-oxoethanimidate.
| Compound Name | methyl 2-[(1-aminoisoquinolin-6-yl)methylamino]-N-ethyl-2-oxoethanimidate |
|---|---|
| PubChem CID | 139341030 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | methyl 2-[(1-aminoisoquinolin-6-yl)methylamino]-N-ethyl-2-oxoethanimidate |
| SMILES | CC/N=C(\OC)C(=O)NCc1ccc2c(N)nccc2c1 |
| InChI | InChI=1S/C15H18N4O2/c1-3-17-15(21-2)14(20)19-9-10-4-5-12-11(8-10)6-7-18-13(12)16/h4-8H,3,9H2,1-2H3,(H2,16,18)(H,19,20)/b17-15- |
| InChIKey | BEIOUPVLWVJCJA-ICFOKQHNSA-N |
| XLogP | 1.50 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|