C11H13N3 — CID 139340899
6-(methylaminomethyl)isoquinolin-1-amine (PubChem CID 139340899) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 6-(methylaminomethyl)isoquinolin-1-amine.
| Compound Name | 6-(methylaminomethyl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 139340899 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 6-(methylaminomethyl)isoquinolin-1-amine |
| SMILES | CNCc1ccc2c(N)nccc2c1 |
| InChI | InChI=1S/C11H13N3/c1-13-7-8-2-3-10-9(6-8)4-5-14-11(10)12/h2-6,13H,7H2,1H3,(H2,12,14) |
| InChIKey | IRKGGELYKZDNFG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |