C22H28N4 — CID 161069047
6-ethyl-5H-cyclopenta[c]pyridin-1-amine;6-ethylisoquinolin-1-amine;methane (PubChem CID 161069047) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is 6-ethyl-5H-cyclopenta[c]pyridin-1-amine;6-ethylisoquinolin-1-amine;methane.
| Compound Name | 6-ethyl-5H-cyclopenta[c]pyridin-1-amine;6-ethylisoquinolin-1-amine;methane |
|---|---|
| PubChem CID | 161069047 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 6-ethyl-5H-cyclopenta[c]pyridin-1-amine;6-ethylisoquinolin-1-amine;methane |
| SMILES | C.CCC1=Cc2c(ccnc2N)C1.CCc1ccc2c(N)nccc2c1 |
| InChI | InChI=1S/C11H12N2.C10H12N2.CH4/c1-2-8-3-4-10-9(7-8)5-6-13-11(10)12;1-2-7-5-8-3-4-12-10(11)9(8)6-7;/h3-7H,2H2,1H3,(H2,12,13);3-4,6H,2,5H2,1H3,(H2,11,12);1H4 |
| InChIKey | UEKJPJKCDGJNHK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |