C35H45N5O5S — CID 173237256
1-(diethylamino)ethyl N-[3-[[cyclohexyl-[2-[4-(2-sulfamoylphenyl)phenyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate (PubChem CID 173237256) has the molecular formula C35H45N5O5S and a molecular weight of 647.84 g/mol. Its IUPAC name is 1-(diethylamino)ethyl N-[3-[[cyclohexyl-[2-[4-(2-sulfamoylphenyl)phenyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate.
| Compound Name | 1-(diethylamino)ethyl N-[3-[[cyclohexyl-[2-[4-(2-sulfamoylphenyl)phenyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 173237256 |
| Molecular Formula | C35H45N5O5S |
| Molecular Weight | 647.84 g/mol |
| Exact Mass | 647.31 |
| IUPAC Name | 1-(diethylamino)ethyl N-[3-[[cyclohexyl-[2-[4-(2-sulfamoylphenyl)phenyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)N(CC)CC)c1cccc(CN(C(=O)Cc2ccc(-c3ccccc3S(N)(=O)=O)cc2)C2CCCCC2)c1 |
| InChI | InChI=1S/C35H45N5O5S/c1-4-39(5-2)25(3)45-35(42)38-34(36)29-13-11-12-27(22-29)24-40(30-14-7-6-8-15-30)33(41)23-26-18-20-28(21-19-26)31-16-9-10-17-32(31)46(37,43)44/h9-13,16-22,25,30H,4-8,14-15,23-24H2,1-3H3,(H2,36,38,42)(H2,37,43,44) |
| InChIKey | USVZHVBIZRGXDI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.84 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|