C29H29N5O3S — CID 10301912
1-(3-carbamimidoylanilino)-1-[(3-methylphenyl)methyl]-3-[4-(2-methylsulfonylphenyl)phenyl]urea (PubChem CID 10301912) has the molecular formula C29H29N5O3S and a molecular weight of 527.65 g/mol. Its IUPAC name is 1-(3-carbamimidoylanilino)-1-[(3-methylphenyl)methyl]-3-[4-(2-methylsulfonylphenyl)phenyl]urea.
| Compound Name | 1-(3-carbamimidoylanilino)-1-[(3-methylphenyl)methyl]-3-[4-(2-methylsulfonylphenyl)phenyl]urea |
|---|---|
| PubChem CID | 10301912 |
| Molecular Formula | C29H29N5O3S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 1-(3-carbamimidoylanilino)-1-[(3-methylphenyl)methyl]-3-[4-(2-methylsulfonylphenyl)phenyl]urea |
| SMILES | [H]/N=C(\N)c1cccc(NN(Cc2cccc(C)c2)C(=O)Nc2ccc(-c3ccccc3S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C29H29N5O3S/c1-20-7-5-8-21(17-20)19-34(33-25-10-6-9-23(18-25)28(30)31)29(35)32-24-15-13-22(14-16-24)26-11-3-4-12-27(26)38(2,36)37/h3-18,33H,19H2,1-2H3,(H3,30,31)(H,32,35) |
| InChIKey | AJOOCPSCKALVEU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|