C33H36N6O5S — CID 10211371
2-(dimethylamino)ethyl (NZ)-N-[amino-[3-[2-benzyl-2-[[4-(2-methylsulfonylphenyl)phenyl]carbamoyl]hydrazinyl]phenyl]methylidene]carbamate (PubChem CID 10211371) has the molecular formula C33H36N6O5S and a molecular weight of 628.75 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl (NZ)-N-[amino-[3-[2-benzyl-2-[[4-(2-methylsulfonylphenyl)phenyl]carbamoyl]hydrazinyl]phenyl]methylidene]carbamate.
| Compound Name | 2-(dimethylamino)ethyl (NZ)-N-[amino-[3-[2-benzyl-2-[[4-(2-methylsulfonylphenyl)phenyl]carbamoyl]hydrazinyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 10211371 |
| Molecular Formula | C33H36N6O5S |
| Molecular Weight | 628.75 g/mol |
| Exact Mass | 628.25 |
| IUPAC Name | 2-(dimethylamino)ethyl (NZ)-N-[amino-[3-[2-benzyl-2-[[4-(2-methylsulfonylphenyl)phenyl]carbamoyl]hydrazinyl]phenyl]methylidene]carbamate |
| SMILES | CN(C)CCOC(=O)/N=C(\N)c1cccc(NN(Cc2ccccc2)C(=O)Nc2ccc(-c3ccccc3S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C33H36N6O5S/c1-38(2)20-21-44-33(41)36-31(34)26-12-9-13-28(22-26)37-39(23-24-10-5-4-6-11-24)32(40)35-27-18-16-25(17-19-27)29-14-7-8-15-30(29)45(3,42)43/h4-19,22,37H,20-21,23H2,1-3H3,(H,35,40)(H2,34,36,41) |
| InChIKey | BQQCELOCBUQHHY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 146.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.75 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|