C37H35N5O6S — CID 10305304
(4-methoxyphenyl)methyl (NZ)-N-[amino-[3-[2-benzyl-2-[[4-(2-methylsulfonylphenyl)phenyl]carbamoyl]hydrazinyl]phenyl]methylidene]carbamate (PubChem CID 10305304) has the molecular formula C37H35N5O6S and a molecular weight of 677.78 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (NZ)-N-[amino-[3-[2-benzyl-2-[[4-(2-methylsulfonylphenyl)phenyl]carbamoyl]hydrazinyl]phenyl]methylidene]carbamate.
| Compound Name | (4-methoxyphenyl)methyl (NZ)-N-[amino-[3-[2-benzyl-2-[[4-(2-methylsulfonylphenyl)phenyl]carbamoyl]hydrazinyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 10305304 |
| Molecular Formula | C37H35N5O6S |
| Molecular Weight | 677.78 g/mol |
| Exact Mass | 677.23 |
| IUPAC Name | (4-methoxyphenyl)methyl (NZ)-N-[amino-[3-[2-benzyl-2-[[4-(2-methylsulfonylphenyl)phenyl]carbamoyl]hydrazinyl]phenyl]methylidene]carbamate |
| SMILES | COc1ccc(COC(=O)/N=C(\N)c2cccc(NN(Cc3ccccc3)C(=O)Nc3ccc(-c4ccccc4S(C)(=O)=O)cc3)c2)cc1 |
| InChI | InChI=1S/C37H35N5O6S/c1-47-32-21-15-27(16-22-32)25-48-37(44)40-35(38)29-11-8-12-31(23-29)41-42(24-26-9-4-3-5-10-26)36(43)39-30-19-17-28(18-20-30)33-13-6-7-14-34(33)49(2,45)46/h3-23,41H,24-25H2,1-2H3,(H,39,43)(H2,38,40,44) |
| InChIKey | DMQKWZKNNJIUON-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.78 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|