C23H23N5O4S — CID 70081521
(2S)-2-(3-carbamimidoylanilino)-N'-[4-(2-methylsulfonylphenyl)phenyl]propanediamide (PubChem CID 70081521) has the molecular formula C23H23N5O4S and a molecular weight of 465.54 g/mol. Its IUPAC name is (2S)-2-(3-carbamimidoylanilino)-N'-[4-(2-methylsulfonylphenyl)phenyl]propanediamide.
| Compound Name | (2S)-2-(3-carbamimidoylanilino)-N'-[4-(2-methylsulfonylphenyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 70081521 |
| Molecular Formula | C23H23N5O4S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | (2S)-2-(3-carbamimidoylanilino)-N'-[4-(2-methylsulfonylphenyl)phenyl]propanediamide |
| SMILES | [H]/N=C(\N)c1cccc(N[C@@H](C(N)=O)C(=O)Nc2ccc(-c3ccccc3S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C23H23N5O4S/c1-33(31,32)19-8-3-2-7-18(19)14-9-11-16(12-10-14)28-23(30)20(22(26)29)27-17-6-4-5-15(13-17)21(24)25/h2-13,20,27H,1H3,(H3,24,25)(H2,26,29)(H,28,30)/t20-/m0/s1 |
| InChIKey | RXSZNPQQGVWINJ-FQEVSTJZSA-N |
| XLogP | 1.95 |
| TPSA | 168.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|