C33H34FN5O5S — CID 173236743
(4-fluorophenyl) N-[3-[[2-oxo-2-[4-(2-sulfamoylphenyl)anilino]ethyl]-pentylamino]benzenecarboximidoyl]carbamate (PubChem CID 173236743) has the molecular formula C33H34FN5O5S and a molecular weight of 631.73 g/mol. Its IUPAC name is (4-fluorophenyl) N-[3-[[2-oxo-2-[4-(2-sulfamoylphenyl)anilino]ethyl]-pentylamino]benzenecarboximidoyl]carbamate.
| Compound Name | (4-fluorophenyl) N-[3-[[2-oxo-2-[4-(2-sulfamoylphenyl)anilino]ethyl]-pentylamino]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 173236743 |
| Molecular Formula | C33H34FN5O5S |
| Molecular Weight | 631.73 g/mol |
| Exact Mass | 631.23 |
| IUPAC Name | (4-fluorophenyl) N-[3-[[2-oxo-2-[4-(2-sulfamoylphenyl)anilino]ethyl]-pentylamino]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)Oc1ccc(F)cc1)c1cccc(N(CCCCC)CC(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C33H34FN5O5S/c1-2-3-6-20-39(27-9-7-8-24(21-27)32(35)38-33(41)44-28-18-14-25(34)15-19-28)22-31(40)37-26-16-12-23(13-17-26)29-10-4-5-11-30(29)45(36,42)43/h4-5,7-19,21H,2-3,6,20,22H2,1H3,(H,37,40)(H2,35,38,41)(H2,36,42,43) |
| InChIKey | CDJIDKWIFXHKFD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 154.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.73 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|