C25H24ClN5O4S — CID 10233106
N-[4-(4-chloro-2-cyanophenyl)phenyl]-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-[methyl(methylsulfonyl)amino]propanamide (PubChem CID 10233106) has the molecular formula C25H24ClN5O4S and a molecular weight of 526.02 g/mol. Its IUPAC name is N-[4-(4-chloro-2-cyanophenyl)phenyl]-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-[methyl(methylsulfonyl)amino]propanamide.
| Compound Name | N-[4-(4-chloro-2-cyanophenyl)phenyl]-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-[methyl(methylsulfonyl)amino]propanamide |
|---|---|
| PubChem CID | 10233106 |
| Molecular Formula | C25H24ClN5O4S |
| Molecular Weight | 526.02 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | N-[4-(4-chloro-2-cyanophenyl)phenyl]-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-[methyl(methylsulfonyl)amino]propanamide |
| SMILES | CN(C(Cc1cccc(/C(N)=N/O)c1)C(=O)Nc1ccc(-c2ccc(Cl)cc2C#N)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C25H24ClN5O4S/c1-31(36(2,34)35)23(13-16-4-3-5-18(12-16)24(28)30-33)25(32)29-21-9-6-17(7-10-21)22-11-8-20(26)14-19(22)15-27/h3-12,14,23,33H,13H2,1-2H3,(H2,28,30)(H,29,32) |
| InChIKey | JTITVQACLWGLIV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 148.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.02 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|