C24H20Cl2N4O3S2 — CID 168874712
3-[2-[[3-(2,4-dichlorophenyl)phenyl]sulfonylamino]-2-(1,3-thiazol-2-yl)ethyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 168874712) has the molecular formula C24H20Cl2N4O3S2 and a molecular weight of 547.49 g/mol. Its IUPAC name is 3-[2-[[3-(2,4-dichlorophenyl)phenyl]sulfonylamino]-2-(1,3-thiazol-2-yl)ethyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[2-[[3-(2,4-dichlorophenyl)phenyl]sulfonylamino]-2-(1,3-thiazol-2-yl)ethyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 168874712 |
| Molecular Formula | C24H20Cl2N4O3S2 |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 546.04 |
| IUPAC Name | 3-[2-[[3-(2,4-dichlorophenyl)phenyl]sulfonylamino]-2-(1,3-thiazol-2-yl)ethyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1cccc(CC(NS(=O)(=O)c2cccc(-c3ccc(Cl)cc3Cl)c2)c2nccs2)c1 |
| InChI | InChI=1S/C24H20Cl2N4O3S2/c25-18-7-8-20(21(26)14-18)16-4-2-6-19(13-16)35(32,33)30-22(24-28-9-10-34-24)12-15-3-1-5-17(11-15)23(27)29-31/h1-11,13-14,22,30-31H,12H2,(H2,27,29) |
| InChIKey | HVDTZWZPCCKZTC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|