C27H30N6O5S2 — CID 174059590
1-[3-[[2-[1-(benzenesulfonamido)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1,3-benzothiazol-6-yl]oxy]propyl]-3-methylurea (PubChem CID 174059590) has the molecular formula C27H30N6O5S2 and a molecular weight of 582.71 g/mol. Its IUPAC name is 1-[3-[[2-[1-(benzenesulfonamido)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1,3-benzothiazol-6-yl]oxy]propyl]-3-methylurea.
| Compound Name | 1-[3-[[2-[1-(benzenesulfonamido)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1,3-benzothiazol-6-yl]oxy]propyl]-3-methylurea |
|---|---|
| PubChem CID | 174059590 |
| Molecular Formula | C27H30N6O5S2 |
| Molecular Weight | 582.71 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | 1-[3-[[2-[1-(benzenesulfonamido)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1,3-benzothiazol-6-yl]oxy]propyl]-3-methylurea |
| SMILES | CNC(=O)NCCCOc1ccc2nc(C(Cc3cccc(C(N)=NO)c3)NS(=O)(=O)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C27H30N6O5S2/c1-29-27(34)30-13-6-14-38-20-11-12-22-24(17-20)39-26(31-22)23(33-40(36,37)21-9-3-2-4-10-21)16-18-7-5-8-19(15-18)25(28)32-35/h2-5,7-12,15,17,23,33,35H,6,13-14,16H2,1H3,(H2,28,32)(H2,29,30,34) |
| InChIKey | BJDHRGWUYATUMB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 168.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.71 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|