C34H40N6O6S2 — CID 174059557
tert-butyl N-[4-[[3-[[1-(1,3-benzothiazol-2-yl)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethyl]sulfamoyl]phenyl]carbamoyl]cyclohexyl]carbamate (PubChem CID 174059557) has the molecular formula C34H40N6O6S2 and a molecular weight of 692.86 g/mol. Its IUPAC name is tert-butyl N-[4-[[3-[[1-(1,3-benzothiazol-2-yl)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethyl]sulfamoyl]phenyl]carbamoyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[3-[[1-(1,3-benzothiazol-2-yl)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethyl]sulfamoyl]phenyl]carbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 174059557 |
| Molecular Formula | C34H40N6O6S2 |
| Molecular Weight | 692.86 g/mol |
| Exact Mass | 692.25 |
| IUPAC Name | tert-butyl N-[4-[[3-[[1-(1,3-benzothiazol-2-yl)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethyl]sulfamoyl]phenyl]carbamoyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(C(=O)Nc2cccc(S(=O)(=O)NC(Cc3cccc(C(N)=NO)c3)c3nc4ccccc4s3)c2)CC1 |
| InChI | InChI=1S/C34H40N6O6S2/c1-34(2,3)46-33(42)37-24-16-14-22(15-17-24)31(41)36-25-10-7-11-26(20-25)48(44,45)40-28(32-38-27-12-4-5-13-29(27)47-32)19-21-8-6-9-23(18-21)30(35)39-43/h4-13,18,20,22,24,28,40,43H,14-17,19H2,1-3H3,(H2,35,39)(H,36,41)(H,37,42) |
| InChIKey | CYQRWTCUVHNOGQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 185.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.86 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|