C30H34N6O3S2 — CID 168913307
N-[3-[[[(1S)-1-(1,3-benzothiazol-2-yl)-2-(3-carbamimidoylphenyl)ethyl]amino]-methylidene-oxo-λ6-sulfanyl]phenyl]-3-morpholin-4-ylpropanamide (PubChem CID 168913307) has the molecular formula C30H34N6O3S2 and a molecular weight of 590.78 g/mol. Its IUPAC name is N-[3-[[[(1S)-1-(1,3-benzothiazol-2-yl)-2-(3-carbamimidoylphenyl)ethyl]amino]-methylidene-oxo-λ6-sulfanyl]phenyl]-3-morpholin-4-ylpropanamide.
| Compound Name | N-[3-[[[(1S)-1-(1,3-benzothiazol-2-yl)-2-(3-carbamimidoylphenyl)ethyl]amino]-methylidene-oxo-λ6-sulfanyl]phenyl]-3-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 168913307 |
| Molecular Formula | C30H34N6O3S2 |
| Molecular Weight | 590.78 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | N-[3-[[[(1S)-1-(1,3-benzothiazol-2-yl)-2-(3-carbamimidoylphenyl)ethyl]amino]-methylidene-oxo-λ6-sulfanyl]phenyl]-3-morpholin-4-ylpropanamide |
| SMILES | [H]/N=C(\N)c1cccc(C[C@H](NS(=C)(=O)c2cccc(NC(=O)CCN3CCOCC3)c2)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C30H34N6O3S2/c1-41(38,24-9-5-8-23(20-24)33-28(37)12-13-36-14-16-39-17-15-36)35-26(19-21-6-4-7-22(18-21)29(31)32)30-34-25-10-2-3-11-27(25)40-30/h2-11,18,20,26H,1,12-17,19H2,(H3,31,32)(H,33,37)(H,35,38)/t26-,41?/m0/s1 |
| InChIKey | JNGRVKDICLTHBG-ZPMZKTPVSA-N |
| XLogP | 3.81 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.78 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|