C21H27N5O2 — CID 110925915
N-[3-[[[amino(anilino)methylidene]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide (PubChem CID 110925915) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[3-[[[amino(anilino)methylidene]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide.
| Compound Name | N-[3-[[[amino(anilino)methylidene]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 110925915 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-[3-[[[amino(anilino)methylidene]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide |
| SMILES | N/C(=N\Cc1cccc(NC(=O)CCN2CCOCC2)c1)Nc1ccccc1 |
| InChI | InChI=1S/C21H27N5O2/c22-21(25-18-6-2-1-3-7-18)23-16-17-5-4-8-19(15-17)24-20(27)9-10-26-11-13-28-14-12-26/h1-8,15H,9-14,16H2,(H,24,27)(H3,22,23,25) |
| InChIKey | DCFSMAOGBYHWBD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|