C23H37N5O2 — CID 111738990
N-[3-[[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide (PubChem CID 111738990) has the molecular formula C23H37N5O2 and a molecular weight of 415.58 g/mol. Its IUPAC name is N-[3-[[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide.
| Compound Name | N-[3-[[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 111738990 |
| Molecular Formula | C23H37N5O2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | N-[3-[[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)CCN2CCOCC2)c1)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C23H37N5O2/c1-4-24-22(28-11-9-23(2,3)18-28)25-17-19-6-5-7-20(16-19)26-21(29)8-10-27-12-14-30-15-13-27/h5-7,16H,4,8-15,17-18H2,1-3H3,(H,24,25)(H,26,29) |
| InChIKey | AURAFCNKIJXPEV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|