C17H26N4O — CID 111738976
2-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]-N-phenylacetamide (PubChem CID 111738976) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]-N-phenylacetamide.
| Compound Name | 2-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 111738976 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]-N-phenylacetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccccc1)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C17H26N4O/c1-4-18-16(21-11-10-17(2,3)13-21)19-12-15(22)20-14-8-6-5-7-9-14/h5-9H,4,10-13H2,1-3H3,(H,18,19)(H,20,22) |
| InChIKey | JTOHOZFBGLKYRQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|