C18H30N4O2S — CID 111739564
N-ethyl-3,3-dimethyl-N'-[[3-(methylsulfamoylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 111739564) has the molecular formula C18H30N4O2S and a molecular weight of 366.53 g/mol. Its IUPAC name is N-ethyl-3,3-dimethyl-N'-[[3-(methylsulfamoylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3,3-dimethyl-N'-[[3-(methylsulfamoylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111739564 |
| Molecular Formula | C18H30N4O2S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-ethyl-3,3-dimethyl-N'-[[3-(methylsulfamoylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(CS(=O)(=O)NC)c1)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C18H30N4O2S/c1-5-20-17(22-10-9-18(2,3)14-22)21-12-15-7-6-8-16(11-15)13-25(23,24)19-4/h6-8,11,19H,5,9-10,12-14H2,1-4H3,(H,20,21) |
| InChIKey | OINBZLKJHKFWSI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|