C16H26N4O2S — CID 111739334
N-ethyl-3,3-dimethyl-N'-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 111739334) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is N-ethyl-3,3-dimethyl-N'-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3,3-dimethyl-N'-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111739334 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | N-ethyl-3,3-dimethyl-N'-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C16H26N4O2S/c1-4-18-15(20-10-9-16(2,3)12-20)19-11-13-5-7-14(8-6-13)23(17,21)22/h5-8H,4,9-12H2,1-3H3,(H,18,19)(H2,17,21,22) |
| InChIKey | ZPJDUJYXTFLSDU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|