C20H34IN5O — CID 111738148
1-[4-[[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide (PubChem CID 111738148) has the molecular formula C20H34IN5O and a molecular weight of 487.43 g/mol. Its IUPAC name is 1-[4-[[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide.
| Compound Name | 1-[4-[[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
|---|---|
| PubChem CID | 111738148 |
| Molecular Formula | C20H34IN5O |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 1-[4-[[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)NC(C)C)cc1)N1CCC(C)(C)C1.I |
| InChI | InChI=1S/C20H33N5O.HI/c1-6-21-18(25-12-11-20(4,5)14-25)22-13-16-7-9-17(10-8-16)24-19(26)23-15(2)3;/h7-10,15H,6,11-14H2,1-5H3,(H,21,22)(H2,23,24,26);1H |
| InChIKey | VVLPDYFERBMQMZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|