C23H40N6O2 — CID 111930493
1-[4-[[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]methyl]phenyl]-3-propan-2-ylurea (PubChem CID 111930493) has the molecular formula C23H40N6O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is 1-[4-[[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]methyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]methyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 111930493 |
| Molecular Formula | C23H40N6O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 1-[4-[[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]methyl]phenyl]-3-propan-2-ylurea |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)NC(C)C)cc1)NCC(C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C23H40N6O2/c1-6-24-22(26-16-21(17(2)3)29-11-13-31-14-12-29)25-15-19-7-9-20(10-8-19)28-23(30)27-18(4)5/h7-10,17-18,21H,6,11-16H2,1-5H3,(H2,24,25,26)(H2,27,28,30) |
| InChIKey | GGMZXBMWFYIVIZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|