C24H40N6O2 — CID 111931488
N-[3-[[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 111931488) has the molecular formula C24H40N6O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-[[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 111931488 |
| Molecular Formula | C24H40N6O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | N-[3-[[[ethylamino-[(3-methyl-2-morpholin-4-ylbutyl)amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)N2CCCC2)c1)NCC(C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C24H40N6O2/c1-4-25-23(27-18-22(19(2)3)29-12-14-32-15-13-29)26-17-20-8-7-9-21(16-20)28-24(31)30-10-5-6-11-30/h7-9,16,19,22H,4-6,10-15,17-18H2,1-3H3,(H,28,31)(H2,25,26,27) |
| InChIKey | MNMAEQFGBFJXGC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|