C25H35N5O — CID 111622670
N-[3-[[[ethylamino-[2-(4-methylphenyl)propylamino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 111622670) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[2-(4-methylphenyl)propylamino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-[[[ethylamino-[2-(4-methylphenyl)propylamino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 111622670 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | N-[3-[[[ethylamino-[2-(4-methylphenyl)propylamino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)N2CCCC2)c1)NCC(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H35N5O/c1-4-26-24(27-17-20(3)22-12-10-19(2)11-13-22)28-18-21-8-7-9-23(16-21)29-25(31)30-14-5-6-15-30/h7-13,16,20H,4-6,14-15,17-18H2,1-3H3,(H,29,31)(H2,26,27,28) |
| InChIKey | ODZXLLOXWAFRTQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|