C22H28ClN5O — CID 111131008
N-[3-[[[[(4-chlorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 111131008) has the molecular formula C22H28ClN5O and a molecular weight of 413.95 g/mol. Its IUPAC name is N-[3-[[[[(4-chlorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-[[[[(4-chlorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 111131008 |
| Molecular Formula | C22H28ClN5O |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N-[3-[[[[(4-chlorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)N2CCCC2)c1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H28ClN5O/c1-2-24-21(25-15-17-8-10-19(23)11-9-17)26-16-18-6-5-7-20(14-18)27-22(29)28-12-3-4-13-28/h5-11,14H,2-4,12-13,15-16H2,1H3,(H,27,29)(H2,24,25,26) |
| InChIKey | YENVRFWXTNFENI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|