C20H32N6O2 — CID 110963493
1-[4-[[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea (PubChem CID 110963493) has the molecular formula C20H32N6O2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 1-[4-[[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 110963493 |
| Molecular Formula | C20H32N6O2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 1-[4-[[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)NC(C)C)cc1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C20H32N6O2/c1-5-21-19(26-12-10-25(11-13-26)16(4)27)22-14-17-6-8-18(9-7-17)24-20(28)23-15(2)3/h6-9,15H,5,10-14H2,1-4H3,(H,21,22)(H2,23,24,28) |
| InChIKey | HTJKLSDSTDJDKX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|