C21H30IN5O2S — CID 111054322
N-[3-[[[amino-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide;hydroiodide (PubChem CID 111054322) has the molecular formula C21H30IN5O2S and a molecular weight of 543.48 g/mol. Its IUPAC name is N-[3-[[[amino-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide;hydroiodide.
| Compound Name | N-[3-[[[amino-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111054322 |
| Molecular Formula | C21H30IN5O2S |
| Molecular Weight | 543.48 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | N-[3-[[[amino-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(NC(=O)CCN2CCOCC2)c1)NCCc1cccs1 |
| InChI | InChI=1S/C21H29N5O2S.HI/c22-21(23-8-6-19-5-2-14-29-19)24-16-17-3-1-4-18(15-17)25-20(27)7-9-26-10-12-28-13-11-26;/h1-5,14-15H,6-13,16H2,(H,25,27)(H3,22,23,24);1H |
| InChIKey | QNUKZYQJCUZFFK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|