C33H39N5O4S2 — CID 168913436
tert-butyl N-[3-[[2-[2-(3-carbamimidoylphenyl)-1-[(cyclopropylidene-oxo-phenyl-λ6-sulfanyl)amino]ethyl]-1,3-benzothiazol-6-yl]oxy]propyl]carbamate (PubChem CID 168913436) has the molecular formula C33H39N5O4S2 and a molecular weight of 633.84 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-[2-(3-carbamimidoylphenyl)-1-[(cyclopropylidene-oxo-phenyl-λ6-sulfanyl)amino]ethyl]-1,3-benzothiazol-6-yl]oxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-[2-(3-carbamimidoylphenyl)-1-[(cyclopropylidene-oxo-phenyl-λ6-sulfanyl)amino]ethyl]-1,3-benzothiazol-6-yl]oxy]propyl]carbamate |
|---|---|
| PubChem CID | 168913436 |
| Molecular Formula | C33H39N5O4S2 |
| Molecular Weight | 633.84 g/mol |
| Exact Mass | 633.24 |
| IUPAC Name | tert-butyl N-[3-[[2-[2-(3-carbamimidoylphenyl)-1-[(cyclopropylidene-oxo-phenyl-λ6-sulfanyl)amino]ethyl]-1,3-benzothiazol-6-yl]oxy]propyl]carbamate |
| SMILES | [H]/N=C(\N)c1cccc(CC(NS(=O)(=C2CC2)c2ccccc2)c2nc3ccc(OCCCNC(=O)OC(C)(C)C)cc3s2)c1 |
| InChI | InChI=1S/C33H39N5O4S2/c1-33(2,3)42-32(39)36-17-8-18-41-24-13-16-27-29(21-24)43-31(37-27)28(20-22-9-7-10-23(19-22)30(34)35)38-44(40,26-14-15-26)25-11-5-4-6-12-25/h4-7,9-13,16,19,21,28H,8,14-15,17-18,20H2,1-3H3,(H3,34,35)(H,36,39)(H,38,40) |
| InChIKey | SJSBILYSOYBZTE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 139.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.84 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|