C31H36N6O7S2 — CID 174050310
tert-butyl N-[2-[[3-[[2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)ethyl]sulfamoyl]benzoyl]amino]ethyl]carbamate (PubChem CID 174050310) has the molecular formula C31H36N6O7S2 and a molecular weight of 668.80 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-[[2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)ethyl]sulfamoyl]benzoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-[[2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)ethyl]sulfamoyl]benzoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 174050310 |
| Molecular Formula | C31H36N6O7S2 |
| Molecular Weight | 668.80 g/mol |
| Exact Mass | 668.21 |
| IUPAC Name | tert-butyl N-[2-[[3-[[2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)ethyl]sulfamoyl]benzoyl]amino]ethyl]carbamate |
| SMILES | COc1ccc2nc(C(Cc3cccc(C(N)=NO)c3)NS(=O)(=O)c3cccc(C(=O)NCCNC(=O)OC(C)(C)C)c3)sc2c1 |
| InChI | InChI=1S/C31H36N6O7S2/c1-31(2,3)44-30(39)34-14-13-33-28(38)21-9-6-10-23(17-21)46(41,42)37-25(16-19-7-5-8-20(15-19)27(32)36-40)29-35-24-12-11-22(43-4)18-26(24)45-29/h5-12,15,17-18,25,37,40H,13-14,16H2,1-4H3,(H2,32,36)(H,33,38)(H,34,39) |
| InChIKey | LPJRDDLCTYTORN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 194.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.80 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|