C31H35N5O6S2 — CID 174059543
tert-butyl 3-[[2-[1-(benzenesulfonamido)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1,3-benzothiazol-6-yl]oxymethyl]azetidine-1-carboxylate (PubChem CID 174059543) has the molecular formula C31H35N5O6S2 and a molecular weight of 637.78 g/mol. Its IUPAC name is tert-butyl 3-[[2-[1-(benzenesulfonamido)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1,3-benzothiazol-6-yl]oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-[1-(benzenesulfonamido)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1,3-benzothiazol-6-yl]oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 174059543 |
| Molecular Formula | C31H35N5O6S2 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.20 |
| IUPAC Name | tert-butyl 3-[[2-[1-(benzenesulfonamido)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethyl]-1,3-benzothiazol-6-yl]oxymethyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(COc2ccc3nc(C(Cc4cccc(C(N)=NO)c4)NS(=O)(=O)c4ccccc4)sc3c2)C1 |
| InChI | InChI=1S/C31H35N5O6S2/c1-31(2,3)42-30(37)36-17-21(18-36)19-41-23-12-13-25-27(16-23)43-29(33-25)26(35-44(39,40)24-10-5-4-6-11-24)15-20-8-7-9-22(14-20)28(32)34-38/h4-14,16,21,26,35,38H,15,17-19H2,1-3H3,(H2,32,34) |
| InChIKey | DOSJHTYEPUNUSH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 156.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|