C33H43N5O5S — CID 68834355
tert-butyl N-[2-[[4-[2-(benzenesulfonamido)-3-(3-carbamimidoylphenoxy)propyl]phenyl]methyl]piperidin-1-yl]carbamate (PubChem CID 68834355) has the molecular formula C33H43N5O5S and a molecular weight of 621.80 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[2-(benzenesulfonamido)-3-(3-carbamimidoylphenoxy)propyl]phenyl]methyl]piperidin-1-yl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[2-(benzenesulfonamido)-3-(3-carbamimidoylphenoxy)propyl]phenyl]methyl]piperidin-1-yl]carbamate |
|---|---|
| PubChem CID | 68834355 |
| Molecular Formula | C33H43N5O5S |
| Molecular Weight | 621.80 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | tert-butyl N-[2-[[4-[2-(benzenesulfonamido)-3-(3-carbamimidoylphenoxy)propyl]phenyl]methyl]piperidin-1-yl]carbamate |
| SMILES | [H]/N=C(\N)c1cccc(OCC(Cc2ccc(CC3CCCCN3NC(=O)OC(C)(C)C)cc2)NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C33H43N5O5S/c1-33(2,3)43-32(39)36-38-19-8-7-11-28(38)21-25-17-15-24(16-18-25)20-27(37-44(40,41)30-13-5-4-6-14-30)23-42-29-12-9-10-26(22-29)31(34)35/h4-6,9-10,12-18,22,27-28,37H,7-8,11,19-21,23H2,1-3H3,(H3,34,35)(H,36,39) |
| InChIKey | NYGWEWINCICQNJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.80 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|